C16H25N3O2 — CID 97377461
(4aR,7aS)-6-(cyclopropylmethyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 97377461) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4aR,7aS)-6-(cyclopropylmethyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aS)-6-(cyclopropylmethyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 97377461 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (4aR,7aS)-6-(cyclopropylmethyl)-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | Cc1noc(C)c1CN1CCO[C@H]2CN(CC3CC3)C[C@H]21 |
| InChI | InChI=1S/C16H25N3O2/c1-11-14(12(2)21-17-11)8-19-5-6-20-16-10-18(9-15(16)19)7-13-3-4-13/h13,15-16H,3-10H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | QJWGYRGNFWAPOU-CVEARBPZSA-N |
| XLogP | 1.59 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |