C17H24N4O2S — CID 97379332
(3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(pyrrolidine-1-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97379332) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(pyrrolidine-1-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(pyrrolidine-1-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97379332 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (3aR,7aR)-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1-(pyrrolidine-1-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cc1nc(CN2C(=O)CC[C@@H]3[C@H]2CCN3C(=O)N2CCCC2)cs1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-18-13(11-24-12)10-21-15-6-9-20(14(15)4-5-16(21)22)17(23)19-7-2-3-8-19/h11,14-15H,2-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | PUQGIZAMZPMFSP-HUUCEWRRSA-N |
| XLogP | 2.23 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |