C13H24N2O3 — CID 97379522
(4aS,8aS)-4a-(methoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide (PubChem CID 97379522) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (4aS,8aS)-4a-(methoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide.
| Compound Name | (4aS,8aS)-4a-(methoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 97379522 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (4aS,8aS)-4a-(methoxymethyl)-N,N-dimethyl-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine-6-carboxamide |
| SMILES | COC[C@@]12CCCO[C@H]1CCN(C(=O)N(C)C)C2 |
| InChI | InChI=1S/C13H24N2O3/c1-14(2)12(16)15-7-5-11-13(9-15,10-17-3)6-4-8-18-11/h11H,4-10H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | OQLYXNBBSYRDES-AAEUAGOBSA-N |
| XLogP | 1.19 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |