C19H21N3O2 — CID 97385687
pyridin-4-yl-(2-pyridin-3-yloxy-7-azaspiro[3.5]nonan-7-yl)methanone (PubChem CID 97385687) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is pyridin-4-yl-(2-pyridin-3-yloxy-7-azaspiro[3.5]nonan-7-yl)methanone.
| Compound Name | pyridin-4-yl-(2-pyridin-3-yloxy-7-azaspiro[3.5]nonan-7-yl)methanone |
|---|---|
| PubChem CID | 97385687 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | pyridin-4-yl-(2-pyridin-3-yloxy-7-azaspiro[3.5]nonan-7-yl)methanone |
| SMILES | O=C(c1ccncc1)N1CCC2(CC1)CC(Oc1cccnc1)C2 |
| InChI | InChI=1S/C19H21N3O2/c23-18(15-3-8-20-9-4-15)22-10-5-19(6-11-22)12-17(13-19)24-16-2-1-7-21-14-16/h1-4,7-9,14,17H,5-6,10-13H2 |
| InChIKey | MKAHYGZXRCYUEK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |