C16H26N4O — CID 97386239
(7R,8aS)-7-(cyclopropylmethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 97386239) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is (7R,8aS)-7-(cyclopropylmethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 97386239 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (7R,8aS)-7-(cyclopropylmethoxy)-2-[(1-methylimidazol-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cn1ccnc1CN1CCN2C[C@H](OCC3CC3)C[C@H]2C1 |
| InChI | InChI=1S/C16H26N4O/c1-18-5-4-17-16(18)11-19-6-7-20-10-15(8-14(20)9-19)21-12-13-2-3-13/h4-5,13-15H,2-3,6-12H2,1H3/t14-,15+/m0/s1 |
| InChIKey | PTUYKIVDYIPRSR-LSDHHAIUSA-N |
| XLogP | 1.11 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |