C18H24N2O3S — CID 97387074
(3aS,5S,7aS)-1-(furan-3-ylmethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole (PubChem CID 97387074) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is (3aS,5S,7aS)-1-(furan-3-ylmethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole.
| Compound Name | (3aS,5S,7aS)-1-(furan-3-ylmethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97387074 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3aS,5S,7aS)-1-(furan-3-ylmethyl)-5-[(2-methyl-1,3-thiazol-4-yl)methoxymethyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole |
| SMILES | Cc1nc(COC[C@@H]2CC[C@H]3[C@H](CCN3Cc3ccoc3)O2)cs1 |
| InChI | InChI=1S/C18H24N2O3S/c1-13-19-15(12-24-13)10-22-11-16-2-3-17-18(23-16)4-6-20(17)8-14-5-7-21-9-14/h5,7,9,12,16-18H,2-4,6,8,10-11H2,1H3/t16-,17-,18-/m0/s1 |
| InChIKey | MRPJMKNULMCPRO-BZSNNMDCSA-N |
| XLogP | 3.38 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |