C15H19FN4O2 — CID 97387281
(3aR,7aR)-N-cyclopropyl-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide (PubChem CID 97387281) has the molecular formula C15H19FN4O2 and a molecular weight of 306.34 g/mol. Its IUPAC name is (3aR,7aR)-N-cyclopropyl-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide.
| Compound Name | (3aR,7aR)-N-cyclopropyl-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
|---|---|
| PubChem CID | 97387281 |
| Molecular Formula | C15H19FN4O2 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3aR,7aR)-N-cyclopropyl-5-(5-fluoropyrimidin-2-yl)-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridine-3a-carboxamide |
| SMILES | O=C(NC1CC1)[C@@]12CCO[C@@H]1CCN(c1ncc(F)cn1)C2 |
| InChI | InChI=1S/C15H19FN4O2/c16-10-7-17-14(18-8-10)20-5-3-12-15(9-20,4-6-22-12)13(21)19-11-1-2-11/h7-8,11-12H,1-6,9H2,(H,19,21)/t12-,15-/m1/s1 |
| InChIKey | NIFOWAYOPLTBOZ-IUODEOHRSA-N |
| XLogP | 0.88 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |