C18H26N2O3 — CID 97387977
(3aS,4R,7aS)-6-cyclopentyl-N-(furan-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide (PubChem CID 97387977) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (3aS,4R,7aS)-6-cyclopentyl-N-(furan-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4R,7aS)-6-cyclopentyl-N-(furan-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97387977 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (3aS,4R,7aS)-6-cyclopentyl-N-(furan-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@H]1CN(C2CCCC2)C[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C18H26N2O3/c21-18(19-10-14-6-3-8-22-14)16-11-20(13-4-1-2-5-13)12-17-15(16)7-9-23-17/h3,6,8,13,15-17H,1-2,4-5,7,9-12H2,(H,19,21)/t15-,16-,17+/m0/s1 |
| InChIKey | AKLAQPFNVBGAQY-YESZJQIVSA-N |
| XLogP | 2.18 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |