C18H24N4O2 — CID 97389120
(4S)-5-[(2-methoxy-3-pyridinyl)methyl]-3-methyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 97389120) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (4S)-5-[(2-methoxy-3-pyridinyl)methyl]-3-methyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | (4S)-5-[(2-methoxy-3-pyridinyl)methyl]-3-methyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 97389120 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (4S)-5-[(2-methoxy-3-pyridinyl)methyl]-3-methyl-4-(prop-2-enoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | C=CCOC[C@@H]1c2c(ncn2C)CCN1Cc1cccnc1OC |
| InChI | InChI=1S/C18H24N4O2/c1-4-10-24-12-16-17-15(20-13-21(17)2)7-9-22(16)11-14-6-5-8-19-18(14)23-3/h4-6,8,13,16H,1,7,9-12H2,2-3H3/t16-/m1/s1 |
| InChIKey | YWLNQMINKDOXGO-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|