C16H21N3OS — CID 97462159
(4R)-3-methyl-4-(prop-2-enoxymethyl)-5-(thiophen-3-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine (PubChem CID 97462159) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is (4R)-3-methyl-4-(prop-2-enoxymethyl)-5-(thiophen-3-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine.
| Compound Name | (4R)-3-methyl-4-(prop-2-enoxymethyl)-5-(thiophen-3-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 97462159 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (4R)-3-methyl-4-(prop-2-enoxymethyl)-5-(thiophen-3-ylmethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine |
| SMILES | C=CCOC[C@H]1c2c(ncn2C)CCN1Cc1ccsc1 |
| InChI | InChI=1S/C16H21N3OS/c1-3-7-20-10-15-16-14(17-12-18(16)2)4-6-19(15)9-13-5-8-21-11-13/h3,5,8,11-12,15H,1,4,6-7,9-10H2,2H3/t15-/m0/s1 |
| InChIKey | CMIDDGLURFLXDV-HNNXBMFYSA-N |
| XLogP | 2.78 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|