About [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone
[(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone (PubChem CID 97393407) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone.
Molecular Properties
| Compound Name | [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone |
| PubChem CID | 97393407 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone |
| SMILES | CN1CCC[C@]12CCCN(C(=O)c1ccc3ccccc3n1)C2 |
| InChI | InChI=1S/C19H23N3O/c1-21-12-4-10-19(21)11-5-13-22(14-19)18(23)17-9-8-15-6-2-3-7-16(15)20-17/h2-3,6-9H,4-5,10-14H2,1H3/t19-/m1/s1 |
| InChIKey | DUUFXENGUSKNDI-LJQANCHMSA-N |
| XLogP | 2.94 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone?
The IUPAC name of [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone (CID 97393407) is [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone.
What is the SMILES notation for [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone?
The canonical SMILES for [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone is CN1CCC[C@]12CCCN(C(=O)c1ccc3ccccc3n1)C2.
What is the InChIKey of [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone?
The InChIKey is DUUFXENGUSKNDI-LJQANCHMSA-N. The full InChI is InChI=1S/C19H23N3O/c1-21-12-4-10-19(21)11-5-13-22(14-19)18(23)17-9-8-15-6-2-3-7-16(15)20-17/h2-3,6-9H,4-5,10-14H2,1H3/t19-/m1/s1.
What are the key properties of [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone?
[(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone has a molecular weight of 309.41 g/mol, XLogP of 2.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-1-methyl-1,9-diazaspiro[4.5]decan-9-yl]-quinolin-2-ylmethanone is sourced from PubChem (CID 97393407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).