C13H19N3OS — CID 97397394
8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one (PubChem CID 97397394) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one.
| Compound Name | 8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97397394 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 8-(1,3-thiazol-2-ylmethylamino)-1-azaspiro[4.5]decan-2-one |
| SMILES | O=C1CCC2(CCC(NCc3nccs3)CC2)N1 |
| InChI | InChI=1S/C13H19N3OS/c17-11-3-6-13(16-11)4-1-10(2-5-13)15-9-12-14-7-8-18-12/h7-8,10,15H,1-6,9H2,(H,16,17) |
| InChIKey | MORGEEQUPPGUSY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |