C18H24N2O2S — CID 97397443
3-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)thiophene-2-carboxamide (PubChem CID 97397443) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 3-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 97397443 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-methyl-N-(2-oxo-1-prop-2-enyl-1-azaspiro[4.5]decan-8-yl)thiophene-2-carboxamide |
| SMILES | C=CCN1C(=O)CCC12CCC(NC(=O)c1sccc1C)CC2 |
| InChI | InChI=1S/C18H24N2O2S/c1-3-11-20-15(21)6-10-18(20)8-4-14(5-9-18)19-17(22)16-13(2)7-12-23-16/h3,7,12,14H,1,4-6,8-11H2,2H3,(H,19,22) |
| InChIKey | UJQMLRAKMRBRMP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|