C18H25N3O4 — CID 97402762
2-[(4aR,7aR)-4-[(4-methoxyphenyl)methyl]-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N,N-dimethylacetamide (PubChem CID 97402762) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[(4aR,7aR)-4-[(4-methoxyphenyl)methyl]-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aR)-4-[(4-methoxyphenyl)methyl]-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 97402762 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[(4aR,7aR)-4-[(4-methoxyphenyl)methyl]-3-oxo-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-N,N-dimethylacetamide |
| SMILES | COc1ccc(CN2C(=O)CO[C@@H]3CN(CC(=O)N(C)C)C[C@H]32)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-19(2)17(22)11-20-9-15-16(10-20)25-12-18(23)21(15)8-13-4-6-14(24-3)7-5-13/h4-7,15-16H,8-12H2,1-3H3/t15-,16-/m1/s1 |
| InChIKey | XHZLIVNUTIGHSW-HZPDHXFCSA-N |
| XLogP | 0.19 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |