C15H24N4O2 — CID 97403341
1-[(4aS,9aR)-7-[(3-methylimidazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanone (PubChem CID 97403341) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(4aS,9aR)-7-[(3-methylimidazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanone.
| Compound Name | 1-[(4aS,9aR)-7-[(3-methylimidazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanone |
|---|---|
| PubChem CID | 97403341 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[(4aS,9aR)-7-[(3-methylimidazol-4-yl)methyl]-2,3,4a,5,6,8,9,9a-octahydro-[1,4]oxazino[2,3-d]azepin-4-yl]ethanone |
| SMILES | CC(=O)N1CCO[C@@H]2CCN(Cc3cncn3C)CC[C@@H]21 |
| InChI | InChI=1S/C15H24N4O2/c1-12(20)19-7-8-21-15-4-6-18(5-3-14(15)19)10-13-9-16-11-17(13)2/h9,11,14-15H,3-8,10H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | ZBRCCLLBAJNSRH-LSDHHAIUSA-N |
| XLogP | 0.63 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |