C15H24N4OS — CID 97404045
(3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 97404045) has the molecular formula C15H24N4OS and a molecular weight of 308.45 g/mol. Its IUPAC name is (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 97404045 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | CN(C)CCN1C(=O)CC[C@@H]2[C@H]1CCN2Cc1nccs1 |
| InChI | InChI=1S/C15H24N4OS/c1-17(2)8-9-19-13-5-7-18(11-14-16-6-10-21-14)12(13)3-4-15(19)20/h6,10,12-13H,3-5,7-9,11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | QGWGXXMICFSYIE-CHWSQXEVSA-N |
| XLogP | 1.27 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |