C17H23F3N4O4S — CID 155829236
2-[(3aR,7aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155829236) has the molecular formula C17H23F3N4O4S and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[(3aR,7aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829236 |
| Molecular Formula | C17H23F3N4O4S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[(3aR,7aR)-5-oxo-1-(1,3-thiazol-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-4-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CN1C(=O)CC[C@@H]2[C@H]1CCN2Cc1nccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O2S.C2HF3O2/c1-17(2)15(21)10-19-12-5-7-18(9-13-16-6-8-22-13)11(12)3-4-14(19)20;3-2(4,5)1(6)7/h6,8,11-12H,3-5,7,9-10H2,1-2H3;(H,6,7)/t11-,12-;/m1./s1 |
| InChIKey | ZPQFAJFZROSBJF-MNMPKAIFSA-N |
| XLogP | 1.43 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |