C19H33N5O — CID 97404682
7-[[(3S)-oxolan-3-yl]methyl]-2-N,4-N-di(propan-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 97404682) has the molecular formula C19H33N5O and a molecular weight of 347.51 g/mol. Its IUPAC name is 7-[[(3S)-oxolan-3-yl]methyl]-2-N,4-N-di(propan-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 7-[[(3S)-oxolan-3-yl]methyl]-2-N,4-N-di(propan-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 97404682 |
| Molecular Formula | C19H33N5O |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.27 |
| IUPAC Name | 7-[[(3S)-oxolan-3-yl]methyl]-2-N,4-N-di(propan-2-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CC(C)Nc1nc2c(c(NC(C)C)n1)CCN(C[C@@H]1CCOC1)CC2 |
| InChI | InChI=1S/C19H33N5O/c1-13(2)20-18-16-5-8-24(11-15-7-10-25-12-15)9-6-17(16)22-19(23-18)21-14(3)4/h13-15H,5-12H2,1-4H3,(H2,20,21,22,23)/t15-/m0/s1 |
| InChIKey | XWRITROSWQMLIS-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |