C16H27N7O — CID 97405178
N,N-dimethyl-2-[[5-[(1-methylimidazol-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine (PubChem CID 97405178) has the molecular formula C16H27N7O and a molecular weight of 333.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[5-[(1-methylimidazol-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[[5-[(1-methylimidazol-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine |
|---|---|
| PubChem CID | 97405178 |
| Molecular Formula | C16H27N7O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | N,N-dimethyl-2-[[5-[(1-methylimidazol-2-yl)methyl]-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methoxy]ethanamine |
| SMILES | CN(C)CCOCc1nnn2c1CN(Cc1nccn1C)CCC2 |
| InChI | InChI=1S/C16H27N7O/c1-20(2)9-10-24-13-14-15-11-22(6-4-7-23(15)19-18-14)12-16-17-5-8-21(16)3/h5,8H,4,6-7,9-13H2,1-3H3 |
| InChIKey | HHNIOEVIOXYZTR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 64.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|