C15H23N7O — CID 97410131
N,N-dimethyl-2-[(5-pyrazin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine (PubChem CID 97410131) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is N,N-dimethyl-2-[(5-pyrazin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[(5-pyrazin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine |
|---|---|
| PubChem CID | 97410131 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | N,N-dimethyl-2-[(5-pyrazin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanamine |
| SMILES | CN(C)CCOCc1nnn2c1CN(c1cnccn1)CCC2 |
| InChI | InChI=1S/C15H23N7O/c1-20(2)8-9-23-12-13-14-11-21(15-10-16-4-5-17-15)6-3-7-22(14)19-18-13/h4-5,10H,3,6-9,11-12H2,1-2H3 |
| InChIKey | OGYQECRCTCCPBQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|