C19H24N4O2 — CID 97406805
(3aR,4R,6aS)-2'-ethyl-1'-methyl-5'-oxo-N-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide (PubChem CID 97406805) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (3aR,4R,6aS)-2'-ethyl-1'-methyl-5'-oxo-N-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide.
| Compound Name | (3aR,4R,6aS)-2'-ethyl-1'-methyl-5'-oxo-N-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide |
|---|---|
| PubChem CID | 97406805 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3aR,4R,6aS)-2'-ethyl-1'-methyl-5'-oxo-N-phenylspiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,4'-imidazole]-2-carboxamide |
| SMILES | CCC1=N[C@@]2(CC[C@@H]3CN(C(=O)Nc4ccccc4)C[C@@H]32)C(=O)N1C |
| InChI | InChI=1S/C19H24N4O2/c1-3-16-21-19(17(24)22(16)2)10-9-13-11-23(12-15(13)19)18(25)20-14-7-5-4-6-8-14/h4-8,13,15H,3,9-12H2,1-2H3,(H,20,25)/t13-,15+,19-/m1/s1 |
| InChIKey | BUKMJXAWWMGCKC-FRIZHTMISA-N |
| XLogP | 2.58 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |