C21H24N6O — CID 97407571
[3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]-pyrrolidin-1-ylmethanone (PubChem CID 97407571) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is [3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 97407571 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc2ccc(N3CCN(c4ncccn4)CC3)n2c1)N1CCCC1 |
| InChI | InChI=1S/C21H24N6O/c28-20(25-10-1-2-11-25)17-4-5-18-6-7-19(27(18)16-17)24-12-14-26(15-13-24)21-22-8-3-9-23-21/h3-9,16H,1-2,10-15H2 |
| InChIKey | TXLXTLGGVBMQAJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |