C22H26N6O — CID 97448108
piperidin-1-yl-[3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]methanone (PubChem CID 97448108) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is piperidin-1-yl-[3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]methanone.
| Compound Name | piperidin-1-yl-[3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]methanone |
|---|---|
| PubChem CID | 97448108 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | piperidin-1-yl-[3-(4-pyrimidin-2-ylpiperazin-1-yl)indolizin-6-yl]methanone |
| SMILES | O=C(c1ccc2ccc(N3CCN(c4ncccn4)CC3)n2c1)N1CCCCC1 |
| InChI | InChI=1S/C22H26N6O/c29-21(26-11-2-1-3-12-26)18-5-6-19-7-8-20(28(19)17-18)25-13-15-27(16-14-25)22-23-9-4-10-24-22/h4-10,17H,1-3,11-16H2 |
| InChIKey | LQBJEKUSWHPZQA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |