C26H21N3O4 — CID 97413880
(E)-N-[(1S)-1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]-3-phenylprop-2-enamide (PubChem CID 97413880) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is (E)-N-[(1S)-1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1S)-1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 97413880 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | (E)-N-[(1S)-1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-phenylethyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](Cc1ccccc1)c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C26H21N3O4/c30-24(14-11-18-7-3-1-4-8-18)27-21(15-19-9-5-2-6-10-19)26-28-25(29-33-26)20-12-13-22-23(16-20)32-17-31-22/h1-14,16,21H,15,17H2,(H,27,30)/b14-11+/t21-/m0/s1 |
| InChIKey | OTJLQCRUAZMYCU-KVDXNUTJSA-N |
| XLogP | 4.58 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|