C22H21N3O4 — CID 171136426
N-[1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-methylpropyl]-3-phenylprop-2-enamide (PubChem CID 171136426) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-methylpropyl]-3-phenylprop-2-enamide.
| Compound Name | N-[1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-methylpropyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171136426 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[1-[3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazol-5-yl]-2-methylpropyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)C(NC(=O)C=Cc1ccccc1)c1nc(-c2ccc3c(c2)OCO3)no1 |
| InChI | InChI=1S/C22H21N3O4/c1-14(2)20(23-19(26)11-8-15-6-4-3-5-7-15)22-24-21(25-29-22)16-9-10-17-18(12-16)28-13-27-17/h3-12,14,20H,13H2,1-2H3,(H,23,26) |
| InChIKey | KMBMEJPENYQMKI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|