C22H23N3O5 — CID 97413863
(E)-3-phenyl-N-[(1R)-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide (PubChem CID 97413863) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(1R)-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(1R)-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 97413863 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | (E)-3-phenyl-N-[(1R)-1-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide |
| SMILES | COc1cc(-c2noc([C@@H](C)NC(=O)/C=C/c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23N3O5/c1-14(23-19(26)11-10-15-8-6-5-7-9-15)22-24-21(25-30-22)16-12-17(27-2)20(29-4)18(13-16)28-3/h5-14H,1-4H3,(H,23,26)/b11-10+/t14-/m1/s1 |
| InChIKey | GRJCAVAEJPTKKW-PLSXKVAHSA-N |
| XLogP | 3.65 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|