C25H29N3O5 — CID 171136450
3-phenyl-N-propan-2-yl-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide (PubChem CID 171136450) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 3-phenyl-N-propan-2-yl-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-propan-2-yl-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171136450 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-phenyl-N-propan-2-yl-N-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]prop-2-enamide |
| SMILES | COc1cc(-c2noc(CCN(C(=O)C=Cc3ccccc3)C(C)C)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H29N3O5/c1-17(2)28(23(29)12-11-18-9-7-6-8-10-18)14-13-22-26-25(27-33-22)19-15-20(30-3)24(32-5)21(16-19)31-4/h6-12,15-17H,13-14H2,1-5H3 |
| InChIKey | PCPVDWZWOPXHSJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|