C26H33N3O6 — CID 93181632
(2R)-1-[benzyl-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-prop-2-enoxypropan-2-ol (PubChem CID 93181632) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2R)-1-[benzyl-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-prop-2-enoxypropan-2-ol.
| Compound Name | (2R)-1-[benzyl-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-prop-2-enoxypropan-2-ol |
|---|---|
| PubChem CID | 93181632 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | (2R)-1-[benzyl-[2-[3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazol-5-yl]ethyl]amino]-3-prop-2-enoxypropan-2-ol |
| SMILES | C=CCOC[C@H](O)CN(CCc1nc(-c2cc(OC)c(OC)c(OC)c2)no1)Cc1ccccc1 |
| InChI | InChI=1S/C26H33N3O6/c1-5-13-34-18-21(30)17-29(16-19-9-7-6-8-10-19)12-11-24-27-26(28-35-24)20-14-22(31-2)25(33-4)23(15-20)32-3/h5-10,14-15,21,30H,1,11-13,16-18H2,2-4H3/t21-/m1/s1 |
| InChIKey | UQYDBEDKRSQDLT-OAQYLSRUSA-N |
| XLogP | 3.37 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|