C16H24N2O4S2 — CID 97414748
N-[4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]-3-methylphenyl]propanamide (PubChem CID 97414748) has the molecular formula C16H24N2O4S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]-3-methylphenyl]propanamide.
| Compound Name | N-[4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]-3-methylphenyl]propanamide |
|---|---|
| PubChem CID | 97414748 |
| Molecular Formula | C16H24N2O4S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]-3-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)NC[C@@]2(OC)CCSC2)c(C)c1 |
| InChI | InChI=1S/C16H24N2O4S2/c1-4-15(19)18-13-5-6-14(12(2)9-13)24(20,21)17-10-16(22-3)7-8-23-11-16/h5-6,9,17H,4,7-8,10-11H2,1-3H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | ICHAZLCFCWMQAP-INIZCTEOSA-N |
| XLogP | 2.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |