C14H19NO5S2 — CID 97414750
methyl 4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]benzoate (PubChem CID 97414750) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is methyl 4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 97414750 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | methyl 4-[[(3S)-3-methoxythiolan-3-yl]methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@@]2(OC)CCSC2)cc1 |
| InChI | InChI=1S/C14H19NO5S2/c1-19-13(16)11-3-5-12(6-4-11)22(17,18)15-9-14(20-2)7-8-21-10-14/h3-6,15H,7-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | KFBOPJMFCDOEMU-AWEZNQCLSA-N |
| XLogP | 1.27 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |