C14H19NO5S — CID 65112879
methyl 4-[(1-hydroxycyclopentyl)methylsulfamoyl]benzoate (PubChem CID 65112879) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 4-[(1-hydroxycyclopentyl)methylsulfamoyl]benzoate.
| Compound Name | methyl 4-[(1-hydroxycyclopentyl)methylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 65112879 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 4-[(1-hydroxycyclopentyl)methylsulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCC2(O)CCCC2)cc1 |
| InChI | InChI=1S/C14H19NO5S/c1-20-13(16)11-4-6-12(7-5-11)21(18,19)15-10-14(17)8-2-3-9-14/h4-7,15,17H,2-3,8-10H2,1H3 |
| InChIKey | JVLSNARUHGWCHU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |