C16H21ClFNO3S — CID 97417138
1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone (PubChem CID 97417138) has the molecular formula C16H21ClFNO3S and a molecular weight of 361.87 g/mol. Its IUPAC name is 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone.
| Compound Name | 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 97417138 |
| Molecular Formula | C16H21ClFNO3S |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[(3S)-3-tert-butylsulfonylpyrrolidin-1-yl]-2-(2-chloro-6-fluorophenyl)ethanone |
| SMILES | CC(C)(C)S(=O)(=O)[C@H]1CCN(C(=O)Cc2c(F)cccc2Cl)C1 |
| InChI | InChI=1S/C16H21ClFNO3S/c1-16(2,3)23(21,22)11-7-8-19(10-11)15(20)9-12-13(17)5-4-6-14(12)18/h4-6,11H,7-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | SIWJCPAJBBFRJM-NSHDSACASA-N |
| XLogP | 2.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |