C17H22FNO3S — CID 56753592
2-(5-fluoro-2-methylphenyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylacetamide (PubChem CID 56753592) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 56753592 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cc1cc(F)ccc1C)C1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22FNO3S/c1-4-8-19(17(3)7-9-23(21,22)12-17)16(20)11-14-10-15(18)6-5-13(14)2/h4-6,10H,1,7-9,11-12H2,2-3H3 |
| InChIKey | ABSNCFLKIVRXSK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|