C18H27F2NO3 — CID 97420986
[(3aS,6aR)-3a-(cyclopentylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(3,3-difluorocyclobutyl)methanone (PubChem CID 97420986) has the molecular formula C18H27F2NO3 and a molecular weight of 343.41 g/mol. Its IUPAC name is [(3aS,6aR)-3a-(cyclopentylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(3,3-difluorocyclobutyl)methanone.
| Compound Name | [(3aS,6aR)-3a-(cyclopentylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(3,3-difluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 97420986 |
| Molecular Formula | C18H27F2NO3 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [(3aS,6aR)-3a-(cyclopentylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(3,3-difluorocyclobutyl)methanone |
| SMILES | O=C(C1CC(F)(F)C1)N1C[C@@H]2COC[C@]2(COCC2CCCC2)C1 |
| InChI | InChI=1S/C18H27F2NO3/c19-18(20)5-14(6-18)16(22)21-7-15-9-24-12-17(15,10-21)11-23-8-13-3-1-2-4-13/h13-15H,1-12H2/t15-,17-/m1/s1 |
| InChIKey | LDKGIMKPFVYCEX-NVXWUHKLSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |