C15H24F3NO4 — CID 155859597
(3aS,6aR)-3a-(cyclopentylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155859597) has the molecular formula C15H24F3NO4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (3aS,6aR)-3a-(cyclopentylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,6aR)-3a-(cyclopentylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859597 |
| Molecular Formula | C15H24F3NO4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3aS,6aR)-3a-(cyclopentylmethoxymethyl)-1,3,4,5,6,6a-hexahydrofuro[3,4-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C1CCC(COC[C@@]23CNC[C@@H]2COC3)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H23NO2.C2HF3O2/c1-2-4-11(3-1)6-15-9-13-8-14-5-12(13)7-16-10-13;3-2(4,5)1(6)7/h11-12,14H,1-10H2;(H,6,7)/t12-,13-;/m1./s1 |
| InChIKey | XRZUZCTUWPNJDB-OJERSXHUSA-N |
| XLogP | 2.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |