C20H24N2O4 — CID 97421189
[(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2,5-dimethylfuran-3-yl)methanone (PubChem CID 97421189) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2,5-dimethylfuran-3-yl)methanone.
| Compound Name | [(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2,5-dimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 97421189 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(3aR,6aR)-3a-(pyridin-4-ylmethoxymethyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-5-yl]-(2,5-dimethylfuran-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2C[C@@H]3COC[C@]3(COCc3ccncc3)C2)c(C)o1 |
| InChI | InChI=1S/C20H24N2O4/c1-14-7-18(15(2)26-14)19(23)22-8-17-10-25-13-20(17,11-22)12-24-9-16-3-5-21-6-4-16/h3-7,17H,8-13H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | HFOUPQLAONXGFV-YLJYHZDGSA-N |
| XLogP | 2.60 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |