C19H24N2O4 — CID 97422219
(2S)-N,8-bis(furan-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide (PubChem CID 97422219) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S)-N,8-bis(furan-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide.
| Compound Name | (2S)-N,8-bis(furan-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
|---|---|
| PubChem CID | 97422219 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (2S)-N,8-bis(furan-2-ylmethyl)-1-oxa-8-azaspiro[4.5]decane-2-carboxamide |
| SMILES | O=C(NCc1ccco1)[C@@H]1CCC2(CCN(Cc3ccco3)CC2)O1 |
| InChI | InChI=1S/C19H24N2O4/c22-18(20-13-15-3-1-11-23-15)17-5-6-19(25-17)7-9-21(10-8-19)14-16-4-2-12-24-16/h1-4,11-12,17H,5-10,13-14H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | XMODVGQVNRRTLR-KRWDZBQOSA-N |
| XLogP | 2.70 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |