C21H25N3O6S — CID 97425858
(4R)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-(7-methoxy-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97425858) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is (4R)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-(7-methoxy-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4R)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-(7-methoxy-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97425858 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (4R)-1-[(4R)-2,2-dimethyloxan-4-yl]-4-(7-methoxy-1,3-benzodioxol-5-yl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | COc1cc([C@H]2SCC(=O)Nc3c2c(=O)[nH]n3[C@@H]2CCOC(C)(C)C2)cc2c1OCO2 |
| InChI | InChI=1S/C21H25N3O6S/c1-21(2)8-12(4-5-30-21)24-19-16(20(26)23-24)18(31-9-15(25)22-19)11-6-13(27-3)17-14(7-11)28-10-29-17/h6-7,12,18H,4-5,8-10H2,1-3H3,(H,22,25)(H,23,26)/t12-,18-/m1/s1 |
| InChIKey | HDVPSPKJGKPLCU-KZULUSFZSA-N |
| XLogP | 2.82 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |