C20H25N3O4S — CID 1409779
(4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 1409779) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 1409779 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | COc1ccccc1[C@H]1SCC(=O)Nc2c1c(=O)[nH]n2[C@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C20H25N3O4S/c1-20(2)10-12(8-9-27-20)23-18-16(19(25)22-23)17(28-11-15(24)21-18)13-6-4-5-7-14(13)26-3/h4-7,12,17H,8-11H2,1-3H3,(H,21,24)(H,22,25)/t12-,17+/m0/s1 |
| InChIKey | UEPNIWSBMBAOKJ-YVEFUNNKSA-N |
| XLogP | 3.09 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |