C23H27N5O4S — CID 97425695
(4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97425695) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97425695 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (4R)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-[5-(4-methoxyphenyl)-1H-pyrazol-4-yl]-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | COc1ccc(-c2[nH]ncc2[C@H]2SCC(=O)Nc3c2c(=O)[nH]n3[C@H]2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C23H27N5O4S/c1-23(2)10-14(8-9-32-23)28-21-18(22(30)27-28)20(33-12-17(29)25-21)16-11-24-26-19(16)13-4-6-15(31-3)7-5-13/h4-7,11,14,20H,8-10,12H2,1-3H3,(H,24,26)(H,25,29)(H,27,30)/t14-,20+/m0/s1 |
| InChIKey | BIHCPASWYDMXNX-VBKZILBWSA-N |
| XLogP | 3.48 |
| TPSA | 114.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |