C19H20F3N3O3S — CID 97426783
(4S)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2,3,4-trifluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione (PubChem CID 97426783) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is (4S)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2,3,4-trifluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione.
| Compound Name | (4S)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2,3,4-trifluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
|---|---|
| PubChem CID | 97426783 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | (4S)-1-[(4S)-2,2-dimethyloxan-4-yl]-4-(2,3,4-trifluorophenyl)-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepine-3,7-dione |
| SMILES | CC1(C)C[C@@H](n2[nH]c(=O)c3c2NC(=O)CS[C@@H]3c2ccc(F)c(F)c2F)CCO1 |
| InChI | InChI=1S/C19H20F3N3O3S/c1-19(2)7-9(5-6-28-19)25-17-13(18(27)24-25)16(29-8-12(26)23-17)10-3-4-11(20)15(22)14(10)21/h3-4,9,16H,5-8H2,1-2H3,(H,23,26)(H,24,27)/t9-,16+/m0/s1 |
| InChIKey | CFSIYHGGBLPFTN-XXFAHNHDSA-N |
| XLogP | 3.50 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|