C15H17N3O3 — CID 97433996
(3R)-3-(hydroxymethyl)-N-isoquinolin-5-ylmorpholine-4-carboxamide (PubChem CID 97433996) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (3R)-3-(hydroxymethyl)-N-isoquinolin-5-ylmorpholine-4-carboxamide.
| Compound Name | (3R)-3-(hydroxymethyl)-N-isoquinolin-5-ylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 97433996 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (3R)-3-(hydroxymethyl)-N-isoquinolin-5-ylmorpholine-4-carboxamide |
| SMILES | O=C(Nc1cccc2cnccc12)N1CCOC[C@H]1CO |
| InChI | InChI=1S/C15H17N3O3/c19-9-12-10-21-7-6-18(12)15(20)17-14-3-1-2-11-8-16-5-4-13(11)14/h1-5,8,12,19H,6-7,9-10H2,(H,17,20)/t12-/m1/s1 |
| InChIKey | NQUNBCYBOJVPPT-GFCCVEGCSA-N |
| XLogP | 1.46 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |