C17H23N3O5S — CID 97434915
1-[(2R)-4-(furan-2-yl)butan-2-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea (PubChem CID 97434915) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 1-[(2R)-4-(furan-2-yl)butan-2-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea.
| Compound Name | 1-[(2R)-4-(furan-2-yl)butan-2-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea |
|---|---|
| PubChem CID | 97434915 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-[(2R)-4-(furan-2-yl)butan-2-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea |
| SMILES | COc1ccc(NC(=O)N[C@H](C)CCc2ccco2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H23N3O5S/c1-12(6-8-14-5-4-10-25-14)18-17(21)19-13-7-9-16(24-2)15(11-13)20-26(3,22)23/h4-5,7,9-12,20H,6,8H2,1-3H3,(H2,18,19,21)/t12-/m1/s1 |
| InChIKey | ATOJXDGSYZQMKO-GFCCVEGCSA-N |
| XLogP | 2.80 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |