C15H23N3O4S — CID 124889174
1-[(3S)-hex-5-en-3-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea (PubChem CID 124889174) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 1-[(3S)-hex-5-en-3-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea.
| Compound Name | 1-[(3S)-hex-5-en-3-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea |
|---|---|
| PubChem CID | 124889174 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-[(3S)-hex-5-en-3-yl]-3-[3-(methanesulfonamido)-4-methoxyphenyl]urea |
| SMILES | C=CC[C@H](CC)NC(=O)Nc1ccc(OC)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H23N3O4S/c1-5-7-11(6-2)16-15(19)17-12-8-9-14(22-3)13(10-12)18-23(4,20)21/h5,8-11,18H,1,6-7H2,2-4H3,(H2,16,17,19)/t11-/m0/s1 |
| InChIKey | QXDBWWJQALSKTN-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|