C19H28ClN3O2 — CID 97437195
[4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-[(3S)-piperidin-3-yl]methanone (PubChem CID 97437195) has the molecular formula C19H28ClN3O2 and a molecular weight of 365.91 g/mol. Its IUPAC name is [4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-[(3S)-piperidin-3-yl]methanone.
| Compound Name | [4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-[(3S)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 97437195 |
| Molecular Formula | C19H28ClN3O2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | [4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-[(3S)-piperidin-3-yl]methanone |
| SMILES | Cc1cc(Cl)ccc1OCCN1CCN(C(=O)[C@H]2CCCNC2)CC1 |
| InChI | InChI=1S/C19H28ClN3O2/c1-15-13-17(20)4-5-18(15)25-12-11-22-7-9-23(10-8-22)19(24)16-3-2-6-21-14-16/h4-5,13,16,21H,2-3,6-12,14H2,1H3/t16-/m0/s1 |
| InChIKey | TWZCUXUBMQKNLL-INIZCTEOSA-N |
| XLogP | 2.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |