C19H25ClN4O4 — CID 131908782
(5S)-5-[3-[4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 131908782) has the molecular formula C19H25ClN4O4 and a molecular weight of 408.89 g/mol. Its IUPAC name is (5S)-5-[3-[4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[3-[4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 131908782 |
| Molecular Formula | C19H25ClN4O4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (5S)-5-[3-[4-[2-(4-chloro-2-methylphenoxy)ethyl]piperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(Cl)ccc1OCCN1CCN(C(=O)CC[C@@H]2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C19H25ClN4O4/c1-13-12-14(20)2-4-16(13)28-11-10-23-6-8-24(9-7-23)17(25)5-3-15-18(26)22-19(27)21-15/h2,4,12,15H,3,5-11H2,1H3,(H2,21,22,26,27)/t15-/m0/s1 |
| InChIKey | KOWKYKGWOYXVAU-HNNXBMFYSA-N |
| XLogP | 1.16 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|