C22H26N4O2 — CID 97438221
1-[4-(1H-benzimidazol-2-yl)phenyl]-3-[4-[(2R)-oxolan-2-yl]butyl]urea (PubChem CID 97438221) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-[4-[(2R)-oxolan-2-yl]butyl]urea.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-[4-[(2R)-oxolan-2-yl]butyl]urea |
|---|---|
| PubChem CID | 97438221 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)phenyl]-3-[4-[(2R)-oxolan-2-yl]butyl]urea |
| SMILES | O=C(NCCCC[C@@H]1CCCO1)Nc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H26N4O2/c27-22(23-14-4-3-6-18-7-5-15-28-18)24-17-12-10-16(11-13-17)21-25-19-8-1-2-9-20(19)26-21/h1-2,8-13,18H,3-7,14-15H2,(H,25,26)(H2,23,24,27)/t18-/m1/s1 |
| InChIKey | MWHRDPBWCAHDAQ-GOSISDBHSA-N |
| XLogP | 4.70 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|