C25H36N4O3 — CID 97439348
(3aS,6aS)-2-acetyl-3a-N-(2-methylpropyl)-1-N'-phenylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-1',3a-dicarboxamide (PubChem CID 97439348) has the molecular formula C25H36N4O3 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3aS,6aS)-2-acetyl-3a-N-(2-methylpropyl)-1-N'-phenylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-1',3a-dicarboxamide.
| Compound Name | (3aS,6aS)-2-acetyl-3a-N-(2-methylpropyl)-1-N'-phenylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-1',3a-dicarboxamide |
|---|---|
| PubChem CID | 97439348 |
| Molecular Formula | C25H36N4O3 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (3aS,6aS)-2-acetyl-3a-N-(2-methylpropyl)-1-N'-phenylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-1',3a-dicarboxamide |
| SMILES | CC(=O)N1C[C@H]2C3(CCN(C(=O)Nc4ccccc4)CC3)CC[C@@]2(C(=O)NCC(C)C)C1 |
| InChI | InChI=1S/C25H36N4O3/c1-18(2)15-26-22(31)25-10-9-24(21(25)16-29(17-25)19(3)30)11-13-28(14-12-24)23(32)27-20-7-5-4-6-8-20/h4-8,18,21H,9-17H2,1-3H3,(H,26,31)(H,27,32)/t21-,25+/m0/s1 |
| InChIKey | DERVJEIBWXDLQY-SQJMNOBHSA-N |
| XLogP | 3.33 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |