C19H33N3O4S — CID 124802345
(3aR,6aR)-2-acetyl-N-(2-methylpropyl)-1'-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide (PubChem CID 124802345) has the molecular formula C19H33N3O4S and a molecular weight of 399.56 g/mol. Its IUPAC name is (3aR,6aR)-2-acetyl-N-(2-methylpropyl)-1'-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide.
| Compound Name | (3aR,6aR)-2-acetyl-N-(2-methylpropyl)-1'-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
|---|---|
| PubChem CID | 124802345 |
| Molecular Formula | C19H33N3O4S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (3aR,6aR)-2-acetyl-N-(2-methylpropyl)-1'-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
| SMILES | CC(=O)N1C[C@@H]2C3(CCN(S(C)(=O)=O)CC3)CC[C@]2(C(=O)NCC(C)C)C1 |
| InChI | InChI=1S/C19H33N3O4S/c1-14(2)11-20-17(24)19-6-5-18(16(19)12-21(13-19)15(3)23)7-9-22(10-8-18)27(4,25)26/h14,16H,5-13H2,1-4H3,(H,20,24)/t16-,19+/m1/s1 |
| InChIKey | SSLQIMVNEZKVPV-APWZRJJASA-N |
| XLogP | 1.06 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |