C17H29N3O5S — CID 97439292
(3aS,6aS)-1'-(2-methoxyacetyl)-N-methyl-2-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide (PubChem CID 97439292) has the molecular formula C17H29N3O5S and a molecular weight of 387.50 g/mol. Its IUPAC name is (3aS,6aS)-1'-(2-methoxyacetyl)-N-methyl-2-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide.
| Compound Name | (3aS,6aS)-1'-(2-methoxyacetyl)-N-methyl-2-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
|---|---|
| PubChem CID | 97439292 |
| Molecular Formula | C17H29N3O5S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (3aS,6aS)-1'-(2-methoxyacetyl)-N-methyl-2-methylsulfonylspiro[3,4,5,6a-tetrahydro-1H-cyclopenta[c]pyrrole-6,4'-piperidine]-3a-carboxamide |
| SMILES | CNC(=O)[C@@]12CCC3(CCN(C(=O)COC)CC3)[C@@H]1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C17H29N3O5S/c1-18-15(22)17-5-4-16(13(17)10-20(12-17)26(3,23)24)6-8-19(9-7-16)14(21)11-25-2/h13H,4-12H2,1-3H3,(H,18,22)/t13-,17+/m0/s1 |
| InChIKey | JPFKCRFRYLBNED-SUMWQHHRSA-N |
| XLogP | -0.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |